| Identification | |
| Name: | 5-Cyanoindole |
| Synonyms: | Indole-5-carbonitrile |
| CAS: | 15861-24-2 |
| EINECS: | 239-986-4 |
| Molecular Formula: | C9H6N2 |
| Molecular Weight: | 142.15734 |
| InChI: | InChI=1S/C9H6N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.24 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. May discolor on exposure to light. |
| Refractive index: | 1.674 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | white to cream crystal |
| Packinggroup: | III |
| HS Code: | 29339990 |
| Sensitive: | Air & Light Sensitive |
| Usage: | Inhibitor of enzyme. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
