Identification |
Name: | 1(2H)-Naphthalenone,3,4-dihydro-2-methyl- |
Synonyms: | 1-Oxo-2-methyl-1,2,3,4-tetrahydronaphthalene;2-Methyl-1-tetralone;2-Methyl-a-tetralone;3,4-Dihydro-2-methyl-1(2H)-naphthalenone; |
CAS: | 1590-08-5 |
EINECS: | 216-461-8 |
Molecular Formula: | C11H12O |
Molecular Weight: | 160.21 |
InChI: | InChI=1/C11H12O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-5,8H,6-7H2,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 15 |
Density: | 1.057 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5535 |
Solubility: | Insoluble |
Appearance: | clear yellow to orange liquid |
Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
Safety Data |
|
|