| Identification | |
| Name: | 1-(3-Methoxyphenyl)piperazine |
| Synonyms: | - |
| CAS: | 16015-71-7 |
| EINECS: | 240-154-8 |
| Molecular Formula: | C11H16N2O |
| Molecular Weight: | 192.26 |
| InChI: | InChI=1/C11H16N2O/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3267 |
| Density: | 1.114 |
| Refractive index: | 1.5815 |
| Appearance: | white to grey or pinkish crystalline powder |
| Specification: |
1-(3-Methoxyphenyl)piperazine , its CAS NO. is 16015-71-7, the synonym is N-(3-Methoxyphenyl)piperazine . |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
