| Identification | |
| Name: | Piperazine,1-(3-methoxyphenyl)-, hydrochloride (1:2) |
| Synonyms: | Piperazine,1-(3-methoxyphenyl)-, dihydrochloride (9CI);4-(3-Methoxyphenyl)piperazine dihydrochloride; |
| CAS: | 6968-76-9 |
| EINECS: | 230-189-7 |
| Molecular Formula: | C11H18Cl2N2O |
| Molecular Weight: | 265.18 |
| InChI: | InChI=1/C11H16N2O.2ClH/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13;;/h2-4,9,12H,5-8H2,1H3;2*1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 161.8°C |
| Boiling Point: | 344°C at 760 mmHg |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | White to gray or light purple powder. |
| Specification: |
Piperazine,1-(3-methoxyphenyl)-, hydrochloride (1:2) , with CAS number of 6968-76-9, can be called 1-(3-Methoxyphenyl)piperazine HCl . |
| Flash Point: | 161.8°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
