| Identification | |
| Name: | 2-Propenoic acid,3-(3-bromo-4-fluorophenyl)- |
| Synonyms: | 3-(3-Bromo-4-fluorophenyl)acrylic acid; |
| CAS: | 160434-49-1 |
| Molecular Formula: | C9H6BrFO2 |
| Molecular Weight: | 245.05 |
| InChI: | InChI=1/C9H6BrFO2/c10-7-5-6(1-3-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/p-1/b4-2+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.685 g/cm3 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | Light yellow solid. |
| Specification: |
It is not compatible with strong Oxidizing agents .And also prevent it to broken down into hazardous decomposition products: Carbon monoxide , Carbon dioxide, Hydrogen fluoride gas, Hydrogen bromide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
