| Identification | |
| Name: | 2-Propenoic acid,3-(3-fluorophenyl)- |
| Synonyms: | Cinnamicacid, m-fluoro- (7CI,8CI);3-(3-Fluorophenyl)propenoic acid;NSC 73988; |
| CAS: | 458-46-8 |
| EINECS: | 207-281-0 |
| Molecular Formula: | C9H7FO2 |
| Molecular Weight: | 168.16 |
| InChI: | InChI=1/C9H7FO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H,11,12)/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.285 g/cm3 |
| Appearance: | white powder |
| Specification: |
?m-Fluorocinnamic acid?, its cas register number is 458-46-8. It also can be called 2-Propenoic acid,3-(3-fluorophenyl)- ;?3-Fluorocinnamic acid ; 3-(3-Fluorophenyl)propenoic acid .It is a?white to light yellow crystal powder. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
