| Identification | |
| Name: | Boron,trihydro(phosphonous difluoride-kP)-, (T-4)- (9CI) |
| Synonyms: | Boron,trihydro(phosphonous difluoride)-, (T-4)-; Phosphonous difluoride, compd. withborane (1:1) (8CI); Borane, compd. with phosphonous difluoride (1:1) (8CI);Phosphonous difluoride, boron complex; Phosphonous difluoride, boron deriv.;Difluorophosphine compd. with borane (1:1) |
| CAS: | 16089-15-9 |
| Molecular Formula: | BF2 H4 P |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/BF2H2P/c1-4(2)3/h1,4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
