| Identification |
| Name: | Boron,trihydro(triphenylphosphine)-, (T-4)- |
| Synonyms: | Borane triphenylphosphine complex;TriphenylphosphinBorane; |
| CAS: | 2049-55-0 |
| Molecular Formula: | C18H18BP |
| Molecular Weight: | 276.12 |
| InChI: | InChI=1/C18H15P.BH3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN3396 |
| Melting Point: | 189-191 °C(lit.)
|
| Flash Point: | 181.7°C |
| Boiling Point: | 360°Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with acids, oxidizing agents, acid chlorides, alcohols. May decompose on exposure to air and moisture. |
| Appearance: | white crystals with an unpleasant smell |
| Packinggroup: | II |
| Flash Point: | 181.7°C |
| Storage Temperature: | Refrigerator |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data |
| |
 |
