| Identification |
| Name: | Peroxydicarbonic acid,C,C'-bis(2-ethylhexyl) ester |
| Synonyms: | Peroxydicarbonicacid, bis(2-ethylhexyl) ester (7CI,8CI,9CI); 2-Ethylhexyl peroxydicarbonate;223EN40; Bis(2-ethylhexyl) perdicarbonate; Bis(2-ethylhexyl) peroxydicarbonate;Bis(ethylhexyl) peroxydicarbonate; Di-2-ethylhexyl percarbonate;Di-2-ethylhexyl peroxydicarbonate; EHP; Espercarb 840M; Kayacarbon EH; Lup 223;Luperox 223; Luperox 223EN40; Luperox 223V75; Lupersol 223; Peroyl OPP; PeroylOPP 60E; Trigonox EHP; Trigonox EHP-C 75; Trigonox EHP-W 40 |
| CAS: | 16111-62-9 |
| EINECS: | 240-282-4 |
| Molecular Formula: | C18H34 O6 |
| Molecular Weight: | 346.45896 |
| InChI: | InChI=1S/C18H34O6/c1-5-9-11-15(7-3)13-21-17(19)23-24-18(20)22-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3113 |
| Melting Point: | <-57 |
| Density: | 1.001 g/cm3 |
| Stability: | Unstable if heated. Heating presents a potential risk of explosion. May be shock sensitive. Flammable. May react violently with organic materials. |
| Refractive index: | 1.446 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Colorless liquid, unpleasant odor |
| Packinggroup: | II |
| Safety Data |
| |
 |
