| Identification | |
| Name: | 2-Pyridylacetic acid hydrochloride |
| Synonyms: | 2-Pyridineaceticacid, hydrochloride (7CI,8CI,9CI);2-(Pyridin-2-yl)acetic acid hydrochloride;2-Pyridine acetic acid hydrochloride; |
| CAS: | 16179-97-8 |
| EINECS: | 240-316-8 |
| Molecular Formula: | C7H7NO2.HCl |
| Molecular Weight: | 173.6 |
| InChI: | InChI=1/C7H7NO2.ClH/c9-7(10)5-6-3-1-2-4-8-6;/h1-4H,5H2,(H,9,10);1H |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | white to off-white solid |
| Specification: |
2-Pyridylacetic acid hydrochloride , its cas register number is 16179-97-8. It also can be called 2-Pyridineacetic acid hydrochloride ; 2-Carboxymethylpyridinium chloride ; 2-Pyridineacetic acid, hydrochloride (1:1) .It is a white to off-white solid. |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: |
2-Pyridylacetic acid hydrochloride (CAS NO.16179-97-8) can be used in nucleophilic substitution. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
