| Identification | |
| Name: | Boronic acid,B-(4-methyl-2-thienyl)- |
| Synonyms: | Boronicacid, (4-methyl-2-thienyl)- (9CI);(4-Methyl-2-thienyl)boronic acid;(4-Methylthien-2-yl)boronic acid; |
| CAS: | 162607-15-0 |
| Molecular Formula: | C5H7BO2S |
| Molecular Weight: | 141.98 |
| InChI: | InChI=1/C5H7BO2S/c1-4-2-5(6(7)8)9-3-4/h2-3,7-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 125-126 ºC |
| Flash Point: | 138.5°C |
| Boiling Point: | 305.4°Cat760mmHg |
| Density: | 1.25g/cm3 |
| Refractive index: | 1.55 |
| Appearance: | White to light yellow crystal powder |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.Store in a tightly closed container. Store in a dry area. Keep refrigerated. (Store below 4°C/39°F.) |
| Flash Point: | 138.5°C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
