| Identification | |
| Name: | octanoic acid, compound with 2,2'-iminodiethanol (1:1) |
| Synonyms: | Octanoic acid, compd. with 2,2'-iminobis(ethanol) (1:1);Caprylic acid, diethanolamine salt;Octanoic acid diethanolamine salt;Octanoic acid, compound with 2,2'-iminodiethanol (1:1);Octanoic acid, compd. with 2,2'-iminodiethanol (1:1);octanoic acid - 2,2'-iminodiethanol (1:1) |
| CAS: | 16530-72-6 |
| EINECS: | 240-600-1 |
| Molecular Formula: | C12H27NO4 |
| Molecular Weight: | 249.3471 |
| InChI: | InChI=1/C8H16O2.C4H11NO2/c1-2-3-4-5-6-7-8(9)10;6-3-1-5-2-4-7/h2-7H2,1H3,(H,9,10);5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107.4°C |
| Boiling Point: | 239.3°C at 760 mmHg |
| Flash Point: | 107.4°C |
| Safety Data | |
 |
|
