Identification |
Name: | Phosphorotrithiousacid, tridodecyl ester |
Synonyms: | Tridodecyl phosphorotrithioite;Trilauryl Trithiophosphite;TRISDODECYL TRITHIOPHOSPHITE;tridodecyl trithiophosphite; |
CAS: | 1656-63-9 |
EINECS: | 216-751-4 |
Molecular Formula: | C36H75PS3 |
Molecular Weight: | 635.15 |
InChI: | InChI=1/C36H75O3PS3/c1-4-7-10-13-16-19-22-25-28-31-34-41-37-40(38-42-35-32-29-26-23-20-17-14-11-8-5-2)39-43-36-33-30-27-24-21-18-15-12-9-6-3/h4-36H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2810 |
Melting Point: | 23°C |
Flash Point: | 357.7°C |
Boiling Point: | 667.8°Cat760mmHg |
Density: | g/cm3 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Flash Point: | 357.7°C |
Safety Data |
|
 |