Identification |
Name: | Boric acid (H3BO3),O,O,O-tridodecyl ester |
Synonyms: | Boric acid(H3BO3), tridodecyl ester (8CI,9CI); Dodecyl borate (6CI,7CI); Dodecyl borate(C12H25O)3B; Lauryl borate; NSC 785 |
CAS: | 2467-15-4 |
EINECS: | 219-582-4 |
Molecular Formula: | C36H75 B O3 |
Molecular Weight: | 566.92 |
InChI: | InChI=1/C36H75BO3/c1-4-7-10-13-16-19-22-25-28-31-34-38-37(39-35-32-29-26-23-20-17-14-11-8-5-2)40-36-33-30-27-24-21-18-15-12-9-6-3/h4-36H2,1-3H3 |
Molecular Structure: |
|
Properties |
Density: | 0.853g/cm3 |
Refractive index: | 1.447 |
Specification: |
Tri-n-dodecyl borate (CAS NO.2467-15-4) is also known to stabilize polycarbonates by adding mixtures of boric acid esters containing oxetane groups and phosphites.
|
Safety Data |
|
|