| Identification | |
| Name: | 1,1'-Biphenyl,2,4',5-trichloro- |
| Synonyms: | Biphenyl,2,4',5-trichloro- (8CI); 2,4',5-Trichlorobiphenyl; 4,2',5'-Trichlorobiphenyl;Delor 103; PCB 31 |
| CAS: | 16606-02-3 |
| Molecular Formula: | C12H7 Cl3 |
| Molecular Weight: | 257.54 |
| InChI: | InChI=1S/C12H7Cl3/c13-9-3-1-8(2-4-9)11-7-10(14)5-6-12(11)15/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3432 9/PG 2 |
| Flash Point: | 227.3°C |
| Boiling Point: | 331.5°C at 760 mmHg |
| Density: | 1.351g/cm3 |
| Refractive index: | 1.603 |
| Specification: |
2,4',5-Trichlorbiphenyl ,its cas register number is 16606-02-3. It also can be called 2,4',5-Trichlorobiphenyl ; Biphenyl, 2,4',5-trichloro- ; and 1,1'-Biphenyl, 2,4',5-trichloro- . |
| Flash Point: | 227.3°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
