| Identification | |
| Name: | 2,4-dihydroxy-6-methyl-5-*nitropyrimidine |
| Synonyms: | 6-methyl-5-nitrouracil; 5-Nitro-6-methyluracil; 2,4-Dihydroxy-6-methyl-5-nitropyrimidine; 6-Metyl-5-nitrouracil |
| CAS: | 16632-21-6 |
| EINECS: | 240-688-1 |
| Molecular Formula: | C5H5N3O4 |
| Molecular Weight: | 171.1109 |
| InChI: | InChI=1S/C5H5N3O4/c1-2-3(8(11)12)4(9)7-5(10)6-2/h1H3,(H2,6,7,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | REMARKS |
| Melting Point: | 300 C (Decomposes) |
| Density: | 1.58 g/cm3 |
| Refractive index: | 1.583 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | yellowish crystals |
| Specification: |
2,4(1H,3H)-Pyrimidinedione,6-methyl-5-nitro- , its cas register number is 16632-21-6. It also can be called 2,4-Dihydroxy-6-methyl-5-nitropyrimidine ; 5-Nitro-6-methyluracil ; and 6-Metyl-5-nitrouracil . |
| Usage: | A synthetic intermediat |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
