| Identification | |
| Name: | 9-Acridinamine,1,2,3,4-tetrahydro-, hydrochloride (1:1) |
| Synonyms: | 9-Acridinamine,1,2,3,4-tetrahydro-, monohydrochloride (9CI); Acridine,9-amino-1,2,3,4-tetrahydro-, hydrochloride (7CI); Acridine,9-amino-1,2,3,4-tetrahydro-, monohydrochloride (8CI);1,2,3,4-Tetrahydro-9-aminoacridine hydrochloride;5,6,7,8-Tetrahydroacridin-9-amine hydrochloride;9-Amino-1,2,3,4-Tetrahydroacridine hydrochloride; CI 970; Cognex; Hydroaminacrine;Romotal; THA; Tacrin hydrochloride; Tacrine hydrochloride; Tenakrin |
| CAS: | 1684-40-8 |
| EINECS: | 216-867-5 |
| Molecular Formula: | C13H14 N2 . Cl H |
| Molecular Weight: | 234.72 |
| InChI: | InChI=1/C13H14N2.ClH/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;/h1,3,5,7H,2,4,6,8H2,(H2,14,15);1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 280-284 °C(lit.) |
| Flash Point: | 230.5°C |
| Boiling Point: | 409.4°Cat760mmHg |
| Density: | g/cm3 |
| Appearance: | pale yellow solid |
| Specification: | Pale Yellow Solid usageEng:A potent centrally acting anticholinesterase, for therapy of memory deficits in patients with Alzheimers disease. THA also selectively blocks potassium channels in the central nervous system, which results in an increased release of acetylcholi Safety Statements:26-36-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Biological Activity: | Potent cholinesterase inhibitor, a cognition enhancer in vivo . |
| Flash Point: | 230.5°C |
| Storage Temperature: | 2-8°C |
| Usage: | A potent centrally acting anticholinesterase, for therapy of memory deficits in patients with Alzheimers disease. THA also selectively blocks potassium channels in the central nervous system, which results in an increased release of acetylcholi |
| Safety Data | |
| Hazard Symbols |
T: Toxic
Xn: Harmful
|
 |
|
