| Identification | |
| Name: | 1H-Purine-2,6-dione,3,7-dihydro-7-hydroxy- |
| Synonyms: | Xanthine,7-hydroxy- (8CI); 7-Hydroxyxanthine |
| CAS: | 16870-90-9 |
| Molecular Formula: | C5H4 N4 O3 |
| Molecular Weight: | 168.13 |
| InChI: | InChI=1/C5H3N4O3/c10-4-2-3(6-1-9(2)12)7-5(11)8-4/h1H,(H2,7,8,10,11)/q-1/p+1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
7-Hydroxyxanthine with cas registry number of 16870-90-9 is also known as 1H-Purine-2,6-dione, 3,7-dihydro-7-hydroxy- ; Xanthine, 7-hydroxy- ; Xanthine 7-N-oxide . 7-Hydroxyxanthine with cas registry number of 16870-90-9 is a tumorigen used in research. |
| Flash Point: | °C |
| Safety Data | |
 |
|
