| Identification |
| Name: | Oxirane, 2,3-diphenyl-,(2R,3S)-rel- |
| Synonyms: | Bibenzyl, a,a'-epoxy-, cis- (8CI); Oxirane, 2,3-diphenyl-, cis-;NSC 133513; Stilbene cis-epoxide; cis-1,2-Diphenylethylene oxide;cis-2,3-Diphenyloxirane; cis-Stilbene oxide |
| CAS: | 1689-71-0 |
| Molecular Formula: | C14H12 O |
| Molecular Weight: | 196.24 |
| InChI: | InChI=1S/C14H12O/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+ |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 38-40 °C(lit.)
|
| Flash Point: | 109 C (closed cup) |
| Stability: | Stable, but may be air sensitive - store under nitrogen. Incompatible with acids, bases, oxidizing agents. |
| Solubility: | |
| Appearance: | solid |
| Flash Point: | 109 C (closed cup) |
| Safety Data |
| |
 |
