Identification |
Name: | Carbonic acid, ethylester, ester with 1-(4-hydroxy-3,5-dimethoxybenzoyl)piperidine (7CI,8CI) |
Synonyms: | BRN 1354593;LG 50,046;Carbonic acid, ethyl ester, ester with 1-(4-hydroxy-3,5-dimethoxybenzoyl)piperidine;AC1L2656;LS-52039;[2,6-dimethoxy-4-(piperidine-1-carbonyl)phenyl] ethyl carbonate;1703-32-8 |
CAS: | 1703-32-8 |
Molecular Formula: | C17H23 N O6 |
Molecular Weight: | 337.3676 |
InChI: | InChI=1/C17H23NO6/c1-4-23-17(20)24-15-13(21-2)10-12(11-14(15)22-3)16(19)18-8-6-5-7-9-18/h10-11H,4-9H2,1-3H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 263.2°C |
Boiling Point: | 511.5°C at 760 mmHg |
Density: | 1.191g/cm3 |
Refractive index: | 1.529 |
Flash Point: | 263.2°C |
Safety Data |
|
|