| Identification |
| Name: | Carbonic acid, ethylester, ester with 1-(4-hydroxy-3,5-dimethoxybenzoyl)pyrrolidine (7CI,8CI) |
| Synonyms: | BRN 1328127;LG 50,050;Carbonic acid, ethyl ester, ester with 1-(4-hydroxy-3,5-dimethoxybenzoyl)pyrrolidine;1703-33-9;AC1L2659;LS-52040;[2,6-dimethoxy-4-(pyrrolidine-1-carbonyl)phenyl] ethyl carbonate;2,6-dimethoxy-4-(pyrrolidin-1-ylcarbonyl)phenyl ethyl carbonate |
| CAS: | 1703-33-9 |
| Molecular Formula: | C16H21 N O6 |
| Molecular Weight: | 323.341 |
| InChI: | InChI=1/C16H21NO6/c1-4-22-16(19)23-14-12(20-2)9-11(10-13(14)21-3)15(18)17-7-5-6-8-17/h9-10H,4-8H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 256.3°C |
| Boiling Point: | 500.3°C at 760 mmHg |
| Density: | 1.218g/cm3 |
| Refractive index: | 1.536 |
| Flash Point: | 256.3°C |
| Safety Data |
| |
 |
