| Identification | |
| Name: | Benzene,1-chloro-4-(1-methylethenyl)- |
| Synonyms: | Styrene,p-chloro-a-methyl- (6CI,7CI,8CI);1-Chloro-4-isopropenylbenzene;2-(4-Chlorophenyl)-1-propene;2-(4-Chlorophenyl)propene;2-(p-Chlorophenyl)propene;4-Chloro-a-methylstyrene;p-Chloro-a-methylstyrene;p-Chloroisopropenylbenzene;a-Methyl-p-chlorostyrene; |
| CAS: | 1712-70-5 |
| EINECS: | 216-984-1 |
| Molecular Formula: | C9H9Cl |
| Molecular Weight: | 152.62 |
| InChI: | InChI=1/C9H9Cl/c1-7(2)8-3-5-9(10)6-4-8/h3-6H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 3.5 |
| Density: | 1.075 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.553-1.557 |
| Solubility: | Insoluble |
| Appearance: | Clear colorless to pale yellow liquid. |
| Specification: | clear colorless to pale yellow liquid Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| HS Code: | 29036990 |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
