| Identification | |
| Name: | 3-Pyridinecarbonitrile,2-methyl- |
| Synonyms: | Nicotinonitrile,2-methyl- (6CI,7CI,8CI);2-Methyl-3-cyanopyridine;3-Cyano-2-methylpyridine;3-Cyano-2-picoline; |
| CAS: | 1721-23-9 |
| Molecular Formula: | C7H6N2 |
| Molecular Weight: | 118.14 |
| InChI: | InChI=1/C7H6N2/c1-6-7(5-8)3-2-4-9-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08 g/cm3 |
| Refractive index: | 1.531 |
| Water Solubility: | at 25 deg C (mg/L): 9457 |
| Solubility: | at 25 deg C (mg/L): 9457 |
| Specification: |
The 3-Cyano-2-methylpyridine with the CAS number 1721-23-9 is also called 3-Pyridinecarbonitrile,2-methyl-. The systematic name is 2-methylpyridine-3-carbonitrile. Its molecular formula is C7H6N2. The product category is Pyridines. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 3-Cyano-2-methylpyridine are: (1)ACD/LogP: 0.96; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.96; (4)ACD/LogD (pH 7.4): 0.96; (5)ACD/BCF (pH 5.5): 3.17; (6)ACD/BCF (pH 7.4): 3.18; (7)ACD/KOC (pH 5.5): 79.55; (8)ACD/KOC (pH 7.4): 79.63; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 36.68 Å2; (13)Index of Refraction: 1.531; (14)Molar Refractivity: 33.74 cm3; (15)Molar Volume: 108.9 cm3; (16)Polarizability: 13.37×10-24cm3; (17)Surface Tension: 47.9 dyne/cm; (18)Enthalpy of Vaporization: 44.66 kJ/mol; (19)Vapour Pressure: 0.194 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
