Identification |
Name: | 4-(acetylamino)phenyl phenyl carbonate |
Synonyms: | 4-Acetamidophenyl phenyl carbonate;BRN 2145663;CARBONIC ACID, PHENYL ESTER, ESTER with 4'-HYDROXYACETANILIDE;AC1L1FAM;(4-acetamidophenyl) phenyl carbonate;LS-52096;17239-23-5 |
CAS: | 17239-23-5 |
Molecular Formula: | C15H13NO4 |
Molecular Weight: | 271.268 |
InChI: | InChI=1/C15H13NO4/c1-11(17)16-12-7-9-14(10-8-12)20-15(18)19-13-5-3-2-4-6-13/h2-10H,1H3,(H,16,17) |
Molecular Structure: |
 |
Properties |
Flash Point: | 231°C |
Boiling Point: | 458.4°C at 760 mmHg |
Density: | 1.279g/cm3 |
Refractive index: | 1.609 |
Flash Point: | 231°C |
Safety Data |
|
 |