Identification |
Name: | 4-(acetylamino)phenyl propan-2-yl carbonate |
Synonyms: | 4-Acetamidophenyl isopropyl carbonate;BRN 2736428;CARBONIC ACID, ISOPROPYL ESTER, ESTER with 4'-HYDROXYACETANILIDE;AC1L1FAP;LS-52076;(4-acetamidophenyl) propan-2-yl carbonate;17239-27-9 |
CAS: | 17239-27-9 |
Molecular Formula: | C12H15NO4 |
Molecular Weight: | 237.2518 |
InChI: | InChI=1/C12H15NO4/c1-8(2)16-12(15)17-11-6-4-10(5-7-11)13-9(3)14/h4-8H,1-3H3,(H,13,14) |
Molecular Structure: |
 |
Properties |
Flash Point: | 202°C |
Boiling Point: | 410.4°C at 760 mmHg |
Density: | 1.186g/cm3 |
Refractive index: | 1.541 |
Flash Point: | 202°C |
Safety Data |
|
 |