| Identification | |
| Name: | Heptanedioic acid,1,7-dimethyl ester |
| Synonyms: | Heptanedioicacid, dimethyl ester (9CI);Pimelic acid, dimethyl ester (6CI,7CI,8CI);Dimethyl 1,7-heptanedioate;Dimethyl heptanedioate;Dimethyl pimelate;NSC52563; |
| CAS: | 1732-08-7 |
| EINECS: | 217-057-4 |
| Molecular Formula: | C9H16O4 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.04 |
| Refractive index: | n20/D 1.431(lit.) |
| Appearance: | clear, colorless clear liquid. |
| Specification: | Clear colorless to slightly yellow liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
