| Identification | |
| Name: | 3-Fluorophenylacetone |
| Synonyms: | 3-Fluorophenyl-2-propanone;2-propanone, 1-(3-fluorophenyl)-;1-(3-Fluorophenyl)acetone;3-Fluorophenylacetone 97%; |
| CAS: | 1737-19-5 |
| Molecular Formula: | C9H9FO |
| Molecular Weight: | 152.17 |
| InChI: | InChI=1/C9H9FO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.086 g/cm3 |
| Refractive index: | 1.497 |
| Appearance: | clear yellow-green liquid |
| Specification: |
3-Fluorophenylacetone , with CAS number of 1737-19-5, can be called 1-(3-Fluorophenyl)acetone ; 2-propanone, 1-(3-fluorophenyl)- ; 3-Fluorophenyl-2-propanone ; 3-Fluorophenylacetone 97% . It is a clear yellow-green liquid. |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
