| Identification |
| Name: | 3,5-Dichloro-2,4,6-trifluoropyridine |
| Synonyms: | 2,4,6-Trifluoro-3,5-dichloropyridine;3,5-Dichloro-2,4,6-trifluoropyridine; 3,5-Dichlorotrifluoropyridine |
| CAS: | 1737-93-5 |
| EINECS: | 217-088-3 |
| Molecular Formula: | C5Cl2F3N |
| Molecular Weight: | 201.96 |
| InChI: | InChI=1/C5Cl2F3N/c6-1-3(8)2(7)5(10)11-4(1)9 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3382 |
| Density: | 1.622 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.478 |
| Solubility: | Insoluble |
| Appearance: | A colorless liquid. |
| Packinggroup: | II |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used to make other chemicals. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
