| Identification | |
| Name: | 3-Chloro-2,5,6-trifluoropyridine |
| Synonyms: | - |
| CAS: | 2879-42-7 |
| EINECS: | -0 |
| Molecular Formula: | C5HClF3N |
| Molecular Weight: | 167.51 |
| InChI: | InChI=1/C5HClF3N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 45.6°C |
| Boiling Point: | 151.7°Cat760mmHg |
| Density: | 1.562g/cm3 |
| Refractive index: | 1.456 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 45.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
