| Identification |
| Name: | 5-Nitroanthranilonitrile |
| Synonyms: | 2-Amino-5-nitrobenzonitrile; 2-Cyano-4-Nitroaniline |
| CAS: | 17420-30-3 |
| EINECS: | 241-446-8 |
| Molecular Formula: | C7H5N3O2 |
| Molecular Weight: | 163.13 |
| InChI: | InChI=1/C7H5N3O2/c8-4-5-3-6(10(11)12)1-2-7(5)9/h1-3H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD |
| Density: | 1.41g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | orange to brown powder |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
