| Identification | |
| Name: | DL-3-Methylcyclopentanone |
| Synonyms: | DL-3-Methylcyclopentanone, 99%; 3-Methylcyclopentanone |
| CAS: | 1757-42-2 |
| EINECS: | 217-148-9 |
| Molecular Formula: | C6H10O |
| Molecular Weight: | 98.14 |
| InChI: | InChI=1/C6H10O/c1-5-2-3-6(7)4-5/h5H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.913 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.433-1.435 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Colorless to pale yellow liquid. |
| Specification: | CLEAR SLIGHTLY YELLOW LIQUID Safety Statements:16 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
