Identification |
Name: | 3-Fluoro-DL-tyrosine |
Synonyms: | dl-3-fluorotyrosine; H-DL-Tyr(3-F)-OH |
CAS: | 403-90-7 |
EINECS: | 206-964-0 |
Molecular Formula: | C9H10FNO3 |
Molecular Weight: | 199.179003 |
InChI: | InChI=1S/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
Molecular Structure: |
 |
Properties |
Transport: | 3276 |
Flash Point: | 172.9°C |
Boiling Point: | 362.4°Cat760mmHg |
Density: | 1.421g/cm3 |
Stability: | Stable. Incompatible with strong reducing agents, strong oxidizing agents. |
Refractive index: | 1.591 |
Water Solubility: | slight Stability Stable. Incompatible with strong reducing agents,strong oxidizing agents. Toxicology Toxic by ingestion. Toxicity data (The meaning of any toxic |
Solubility: | slight |
Appearance: | white solid |
Specification: | white solid Safety Statements:36 36:Wear suitable protective clothing |
Packinggroup: | II |
Flash Point: | 172.9°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
 |