| Identification | |
| Name: | DL-Tyrosine |
| Synonyms: | 3-(4-Hydroxyphenyl)-DL-alanine; 3-(4-Hydroxyphenyl)-DL-alanine~H-DL-Tyr-OH |
| CAS: | 556-03-6 |
| EINECS: | 209-113-1 |
| Molecular Formula: | C9H11NO3 |
| Molecular Weight: | 181.18854 |
| InChI: | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | STABILITY |
| Density: | 1.333 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystals |
| Specification: | white powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29225000 |
| Flash Point: | STABILITY |
| Storage Temperature: | Store at RT. |
| Color: | FINE SILKY NEEDLES White crystals |
| Usage: | L form is a nonessential amino acid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
