| Identification | |
| Name: | Pyridine,4-ethoxy-2-fluoro- |
| Synonyms: | Pyridine, 4-ethoxy-2-fluoro- (9CI); |
| CAS: | 175965-82-9 |
| Molecular Formula: | C7H8 F N O |
| Molecular Weight: | 141.1429232 |
| InChI: | InChI=1/C7H8FNO/c1-2-10-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.108g/cm3 |
| Refractive index: | 1.471 |
| Specification: |
The 4-Ethoxy-2-fluoropyridine with cas registry number of 175965-82-9, is also called Pyridine, 4-ethoxy-2-fluoro- (9CI) .The 4-Ethoxy-2-fluoropyridine belongs to the following product categorie: pyridine . Physical properties of 4-Ethoxy-2-fluoropyridine :(1)ACD/LogP: 1.69; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.69; (4)ACD/LogD (pH 7.4): 1.69; (5)ACD/BCF (pH 5.5): 11.4; (6)ACD/BCF (pH 7.4): 11.4; (7)ACD/KOC (pH 5.5): 198.62; (8)ACD/KOC (pH 7.4): 198.62; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 22.12 Å2; (13)Index of Refraction: 1.471; (14)Molar Refractivity: 35.64 cm3; (15)Molar Volume: 127.3 cm3; (16)Polarizability: 14.13×10-24cm3; (17)Surface Tension: 32.8 dyne/cm; (18)Enthalpy of Vaporization: 40.6 kJ/mol; (19)Vapour Pressure: 0.88 mmHg at 25°C . You can still convert the following datas into molecular structure: (1)SMILES:Fc1cc(OCC)ccn1; (2)InChI:InChI=1/C7H8FNO/c1-2-10-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3; (3)InChIKey:GDBFDUQCZKHTRP-UHFFFAOYAY; (4)Std. InChI:InChI=1S/C7H8FNO/c1-2-10-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3; (5)Std. InChIKey:GDBFDUQCZKHTRP-UHFFFAOYSA-N. |
| Safety Data | |
 |
|
