| Identification |
| Name: | D-Galactose,2-amino-2-deoxy-, hydrochloride (1:1) |
| Synonyms: | D-Galactose,2-amino-2-deoxy-, hydrochloride (9CI);Galactosamine hydrochloride (6CI);Galactose, 2-amino-2-deoxy-, hydrochloride, D- (8CI);2-Amino-2-deoxy-D-galactose hydrochloride;Chondrosamine hydrochloride;D-Galactosamine hydrochloride; |
| CAS: | 1772-03-8 |
| EINECS: | 217-198-1 |
| Molecular Formula: | C6H13NO5.HCl |
| Molecular Weight: | 215.63 |
| InChI: | InChI=1/C6H13NO5.ClH/c7-3(1-8)5(11)6(12)4(10)2-9;/h1,3-6,9-12H,2,7H2;1H/t3-,4+,5+,6-;/m0./s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 275.8 oC |
| Boiling Point: | 532.5 oC at 760 mmHg |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 96 o (589NM C=1,H2O,24 HRS) |
| Water Solubility: | SOLUBLE |
| Solubility: | H2O: 50 mg/mL, clear, colorless |
| Appearance: | White powder |
| Flash Point: | 275.8 oC |
| Storage Temperature: | Store at 2-8 |
| Sensitive: | Hygroscopic |
| Usage: | A constituent of some glycoprotein hormones. |
| Safety Data |
| |
 |
