| Identification | |
| Name: | D-Mannose,2-amino-2-deoxy-, hydrochloride (1:1) |
| Synonyms: | D-Mannose,2-amino-2-deoxy-, hydrochloride (9CI);Mannose, 2-amino-2-deoxy-,hydrochloride, D- (8CI);2-Amino-2-deoxy-D-mannose hydrochloride;D-Mannosaminehydrochloride; |
| CAS: | 5505-63-5 |
| EINECS: | 226-847-8 |
| Molecular Formula: | C6H14ClNO5 |
| Molecular Weight: | 231.63146 |
| InChI: | InChI=1S/C6H13NO6.ClH/c7-3(6(12)13)5(11)4(10)2(9)1-8;/h2-5,8-11H,1,7H2,(H,12,13);1H/t2-,3+,4-,5-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 168 oC (dec.) |
| Water Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Appearance: | powder to fine crystals, white/colorless |
| Specification: | White Crystalline Solid usageEng:A pharmaceutical compound used in the development of mannosylated liposomes for bioadhesive oral drug delivery via M cells of Peyer''s patches. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29329985 |
| Sensitive: | Hygroscopic |
| Usage: | A pharmaceutical compound used in the development of mannosylated liposomes for bioadhesive oral drug delivery via M cells of Peyer''s patches. |
| Safety Data | |
 |
|
