| Identification | |
| Name: | 1,6-Pyrenedione |
| Synonyms: | 1,6-Pyrenequinone;3,8-Pyrenedione; 3,8-Pyrenequinone; NSC 142616 |
| CAS: | 1785-51-9 |
| EINECS: | 217-238-8 |
| Molecular Formula: | C16H8 O2 |
| Molecular Weight: | 232.24 |
| InChI: | InChI=1/C16H8O2/c17-13-8-4-10-2-6-12-14(18)7-3-9-1-5-11(13)16(10)15(9)12/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177.8°C |
| Boiling Point: | 479.2°Cat760mmHg |
| Density: | 1.439g/cm3 |
| Refractive index: | 1.783 |
| Specification: |
1,6-Pyrenedione(CAS NO.1785-51-9) is a RN given refers to cpd with locants for oxo moiety in positions 1 and 6. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 177.8°C |
| Safety Data | |
 |
|
