| Identification | |
| Name: | 1,8-Pyrenedione |
| Synonyms: | 1,8-Pyrenequinone;3,10-Pyrenedione; 3,10-Pyrenequinone; 3,6-Pyrenedione; 3,6-Pyrenequinone |
| CAS: | 2304-85-0 |
| EINECS: | 218-966-9 |
| Molecular Formula: | C16H8 O2 |
| Molecular Weight: | 232.24 |
| InChI: | InChI=1/C16H8O2/c17-13-7-3-9-1-2-10-4-8-14(18)12-6-5-11(13)15(9)16(10)12/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177.8°C |
| Boiling Point: | 479.2°Cat760mmHg |
| Density: | 1.439g/cm3 |
| Refractive index: | 1.783 |
| Specification: |
1,8-Pyrenedione(CAS NO.2304-85-0) is a RN given refers to cpd with locants for oxo moiety in positions 1 and 8. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 177.8°C |
| Safety Data | |
 |
|
