| Identification | |
| Name: | Methanone,(2-chlorophenyl)(4-fluorophenyl)- |
| Synonyms: | Benzophenone,2-chloro-4'-fluoro- (7CI,8CI);2-Chlorophenyl4-fluorophenyl ketone;NSC 141026; |
| CAS: | 1806-23-1 |
| EINECS: | 217-300-4 |
| Molecular Formula: | C13H8ClFO |
| Molecular Weight: | 234.66 |
| InChI: | InChI=1/C13H8ClFO/c14-12-4-2-1-3-11(12)13(16)9-5-7-10(15)8-6-9/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.277 g/cm3 |
| Refractive index: | 1.577 |
| Appearance: | white crystal |
| Specification: | Safety Statements:28 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
