| Identification | |
| Name: | 5-Chlorouracil |
| Synonyms: | 2,4 (1H,3H)-Pyrimidinedione, 5-chloro-;2,4(1H,3H)-Pyrimidinedione, 5-chloro-;Uracil, 5-chloro- (VAN) (8CI);Uracil, 5-chloro-;5-Chloro-2,4-pyrimidinedione;5-Chlorouracil,5-Chloro-2,4-dihydroxypyrimidine; |
| CAS: | 1820-81-1 |
| EINECS: | 217-339-7 |
| Molecular Formula: | C4H3ClN2O2 |
| Molecular Weight: | 146.53 |
| InChI: | InChI=1/C4H3ClN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.61 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.587 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | white crystals |
| HS Code: | 29335995 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Used for the experimental and clinical treatment of neoplastic and viral diseases |
| Safety Data | |
| Hazard Symbols | |
 |
|
