| Identification |
| Name: | SB 225002 |
| Synonyms: | SB 225002;N-(2-HYDROXY-4-NITROPHENYL)-N'-(2-BROMOPHENYL)UREA;N-(2-BROMOPHENYL)-N'-(2-HYDROXY-4-NITROPHENYL)UREA |
| CAS: | 182498-32-4 |
| Molecular Formula: | C13H10BrN3O4 |
| Molecular Weight: | 352.14 |
| InChI: | InChI=1/C13H10BrN3O4/c14-9-3-1-2-4-10(9)15-13(19)16-11-6-5-8(17(20)21)7-12(11)18/h1-7,18H,(H2,15,16,19) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 196.7°C |
| Boiling Point: | 401.6°C at 760 mmHg |
| Density: | 1.793g/cm3 |
| Refractive index: | 1.765 |
| Biological Activity: | Potent and selective CXCR2 chemokine receptor antagonist (IC 50 = 22 nM) that displays > 150-fold selectivity over CXCR1 receptors. Causes inhibition of IL-8 and GRO α -mediated calcium mobilization in HL60 cells (IC 50 values are 8 and 10 nM respectively). Prevents IL-8-induced neutrophil chemotaxis in vitro and sequestration in vivo . Inhibits HIV replication in lymphocytes and macrophages. |
| Flash Point: | 196.7°C |
| Storage Temperature: | -20°C |
| Safety Data |
| |
 |
