Identification |
Name: | Nonanoic acid,4-methyl-2-oxo-2H-1-benzopyran-7-yl ester |
Synonyms: | Nonanoic acid,ester with 7-hydroxy-4-methylcoumarin (8CI);Coumarin, 7-hydroxy-4-methyl-,nonanoate;4-Methylumbelliferone nonanoate;4-Methylumbelliferyl nonanoate;Nonanoyl 4-methylumbelliferone;4-Methyl-2-oxo-2H-chromen-7-yl nonanoate; |
CAS: | 18319-93-2 |
EINECS: | 242-208-6 |
Molecular Formula: | C19H24O4 |
Molecular Weight: | 316.39146 |
InChI: | InChI=1S/C19H24O4/c1-3-4-5-6-7-8-9-18(20)22-15-10-11-16-14(2)12-19(21)23-17(16)13-15/h10-13H,3-9H2,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 48-52ºC |
Flash Point: | 224.9 ºC |
Boiling Point: | 453.2 ºC at 760 mmHg |
Density: | 1.097 g/cm3 |
Refractive index: | 1.524 |
Water Solubility: | Insoluble in water |
Solubility: | Insoluble in water |
Appearance: | White to off-white powder |
Flash Point: | 224.9 ºC |
Safety Data |
|
|