| Identification | |
| Name: | 4-Pyridinecarboxylicacid, 2,3-dichloro- |
| Synonyms: | 2,3-Dichloroisonicotinic acid;2,3-Dichloro-4-pyridinecarboxylicacid; |
| CAS: | 184416-84-0 |
| Molecular Formula: | C6H3Cl2NO2 |
| Molecular Weight: | 192.00 |
| InChI: | InChI=1/C6H3Cl2NO2/c7-4-3(6(10)11)1-2-9-5(4)8/h1-2H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 203.9 ºC |
| Boiling Point: | 413.6 ºC at 760 mmHg |
| Density: | 1.612 g/cm3 |
| Refractive index: | 1.605 |
| Specification: |
2,3-Dichloropyridine-4-carboxylic acid , its cas register number is 184416-84-0. It also can be called 4-pyridinecarboxylic acid, 2,3-dichloro- ; and 2,3-Dichloro-4-pyridinecarboxylic acid . |
| Flash Point: | 203.9 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
