| Identification |
| Name: | ketamine hydrochloride |
| Synonyms: | Ketamine HCl; 2-(2-chlorophenyl)-2-(methylamino)cyclohexanone; 2-(2-chlorophenyl)-2-(methylamino)cyclohexanone hydrochloride (1:1) |
| CAS: | 1867-66-9 |
| EINECS: | 217-484-6 |
| Molecular Formula: | C13H16 Cl N O . Cl H |
| Molecular Weight: | 274.19 |
| InChI: | InChI=1/C13H16ClNO.ClH/c1-15-13(9-5-4-8-12(13)16)10-6-2-3-7-11(10)14;/h2-3,6-7,15H,4-5,8-9H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Melting Point: | 262 - 263 |
| Density: | 1.17g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | 0.2 g/mL (20 C) |
| Appearance: | white to off-white crystalline powder |
| Packinggroup: | III |
| Biological Activity: | Non-competitive NMDA receptor antagonist (EC 50 values are 13.6 and 17.6 μ M for NR1/NR2A and NR1/NR2B subunit combinations respectively). Dissociative anesthetic. |
| Color: | white |
| Usage: | Medication. Selective nmda glutamate receptor antagonist; veterinary anesthetic. |
| Safety Data |
| |
 |
