| Identification | |
| Name: | 2-Bromophenylacetic acid |
| Synonyms: | 2-(2-bromophenyl)acetic acid;2-Bromophenyl acetic acid;2-(2-bromophenyl)acetate; |
| CAS: | 18698-97-0 |
| EINECS: | 242-509-2 |
| Molecular Formula: | C8H7BrO2 |
| Molecular Weight: | 215.04 |
| InChI: | InChI=1/C8H7BrO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.616 g/cm3 |
| Stability: | No data. |
| Solubility: | Very soluble |
| Appearance: | almost white to light beige crystals or powder |
| Specification: |
?2-Bromophenylacetic acid (CAS NO.18698-97-0) is also named as Benzeneacetic acid, 2-bromo- ;?2-Bromophenyl acetic acid ;?2-Bromo phenylacetic acid .?2-Bromophenylacetic acid (CAS NO.18698-97-0) is almost white to light beige crystals or powder. |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
