| Identification | |
| Name: | 1-Butanethiol,2-methyl- |
| Synonyms: | 1-Mercapto-2-methylbutane; |
| CAS: | 1878-18-8 |
| EINECS: | 217-515-3 |
| Molecular Formula: | C5H12S |
| Molecular Weight: | 104.21 |
| InChI: | InChI=1/C5H12S/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1111 |
| Density: | 0.84 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4455-1.4475 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | colourless liquid with disagreeable odour |
| Specification: |
1-Butanethiol,2-methyl- , with CAS number of 1878-18-8, can be called 2-Methyl-1-butanethio ; 2-Methyl-butane-1-thiol ; t-Amylmercaptan ; 2-Methyl-1-butanethiol ; 2-Methylbutyl mercaptan ; 2-Methylbutanethiol . It is a clear colourless liquid. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
