| Identification | |
| Name: | 1-Butanethiol,3-methyl- |
| Synonyms: | 2-Methyl-4-butanethiol;3-Methyl-1-butanethiol;3-Methylbutanethiol;3-Methylbutyl mercaptan;Isoamylmercaptan;Isoamyl sulfhydrate;Isopentanethiol;Isopentyl mercaptan;Isopentylthiol;iso-Amyl mercaptan; |
| CAS: | 541-31-1 |
| EINECS: | 208-774-3 |
| Molecular Formula: | C5H12S |
| Molecular Weight: | 104.21 |
| InChI: | InChI=1/C5H12S/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1228 |
| Density: | 0.835 |
| Refractive index: | 1.442-1.446 |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: |
1-Butanethiol,3-methyl- , with CAS number of 541-31-1, can be called 2-Methyl-4-butanethiol ; 3,3-dimethyl-1-propanethiol ; 3-methyl-1-butanethio ; 3-Methyl-1-butanthiol ; 3-methyl-butane-1-thiol ; 3-methylbutane-1-thiol ; Isoamyl sulfhydrate ; isoamylthiol . It is a clear colorless to slightly yellow liquid. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xn:Harmful
|
 |
|
