| Identification | |
| Name: | L-Alanine, labeled withcarbon-14 |
| Synonyms: | Alanine,labeled with carbon-14, L- (8CI);L-Alanine-14C;L-Alanine-U-14C;[14C]Alanine; |
| CAS: | 18875-37-1 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.0932 |
| InChI: | InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
| Molecular Structure: | ![(C3H7NO2) Alanine,labeled with carbon-14, L- (8CI);L-Alanine-14C;L-Alanine-U-14C;[14C]Alanine;](https://img1.guidechem.com/chem/e/dict/147/18875-37-1.jpg) |
| Properties | |
| Transport: | UN 2910 7 |
| Melting Point: | 297 deg C (decomposes) |
| Density: | 1.161 g/cm3 |
| Solubility: | Solubility in cold 80% ethanol = 0.2% Slightly soluble in ethanol, pyridine; insoluble in ether, acetone In water, 1.64X10+5 mg/L at 25 deg C |
| Storage Temperature: | 2-8°C |
| Color: | Orthorhombic crystals from water White crystalline powder |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
