| Identification | |
| Name: | L-Leucine, labeled withcarbon-14 |
| Synonyms: | Leucine,labeled with carbon-14, L- (8CI); Leucine-U-14C; [14C]-L-Leucine |
| CAS: | 70-45-1 |
| Molecular Formula: | C6H13 N O2 |
| Molecular Weight: | 143.28 |
| InChI: | InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| Molecular Structure: | ![(C6H13NO2) Leucine,labeled with carbon-14, L- (8CI); Leucine-U-14C; [14C]-L-Leucine](https://img1.guidechem.com/chem/e/dict/146/70-45-1.jpg) |
| Properties | |
| Transport: | UN 2910 7 |
| Melting Point: | 293 deg C |
| Boiling Point: | Sublimes at 145-148 deg C. Decomposes at 293-295 deg C (rapid heating, sealed tube) |
| Solubility: | Solubility in 99% alcohol: 0.72; in acetic acid: 10.9. Insoluble in ether. Solubility in water (g/L): 22.7 (0 deg C); 24.26 (25 deg C); 28.87 (50 deg C); 38.23 (75 deg C); 56.38 (100 deg C) In water, 2.15X10+4 mg/L at 25 deg C |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | 2-8°C |
| Color: | White glistening hexagonal plates from aqueous alcohol White crystals |
| Safety Data | |
 |
|
