Identification |
Name: | 2-Propenoic acid,2-methyl-, 2-chloroethyl ester |
Synonyms: | Methacrylicacid, 2-chloroethyl ester (6CI,7CI,8CI); Ethanol, 2-chloro-, methacrylate(8CI); 2-Chloroethyl methacrylate; Methacrylic acid b-chloroethyl ester; NSC 18595; b-Chloroethyl methacrylate |
CAS: | 1888-94-4 |
EINECS: | 217-566-1 |
Molecular Formula: | C6H9ClO2 |
Molecular Weight: | 148.58 |
InChI: | InChI=1/C6H9ClO2/c1-5(2)6(8)9-4-3-7/h1,3-4H2,2H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2810 |
Flash Point: | 75.3°C |
Density: | 59 |
Refractive index: | 1.4510 |
Specification: |
Chloroethyl methacrylate with cas registry number of 1888-94-4 is also known as 2-Chloroethyl methacrylate ; 2-Propenoic acid, 2-methyl-, 2-chloroethyl ester ; 3-02-00-01285 (Beilstein Handbook Reference) ; Methacrylic acid beta-chloroethyl ester ; Methacrylic acid, 2-chloroethyl ester ; NSC 18595 .
|
Packinggroup: | III |
Flash Point: | 75.3°C |
Safety Data |
|
 |